About butylsulfonyl butane-1-sulfonate
butylsulfonyl butane-1-sulfonate (PubChem CID 13107255) has the molecular formula C8H18O5S2
and a molecular weight of 258.36 g/mol. Its IUPAC name is butylsulfonyl butane-1-sulfonate.
Molecular Properties
| Compound Name | butylsulfonyl butane-1-sulfonate |
| PubChem CID | 13107255 |
| Molecular Formula | C8H18O5S2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | butylsulfonyl butane-1-sulfonate |
| SMILES | CCCCS(=O)(=O)OS(=O)(=O)CCCC |
| InChI | InChI=1S/C8H18O5S2/c1-3-5-7-14(9,10)13-15(11,12)8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | HXJNXHRCVBYKFI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze butylsulfonyl butane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylsulfonyl butane-1-sulfonate?
The IUPAC name of butylsulfonyl butane-1-sulfonate (CID 13107255) is butylsulfonyl butane-1-sulfonate.
What is the SMILES notation for butylsulfonyl butane-1-sulfonate?
The canonical SMILES for butylsulfonyl butane-1-sulfonate is CCCCS(=O)(=O)OS(=O)(=O)CCCC.
What is the InChIKey of butylsulfonyl butane-1-sulfonate?
The InChIKey is HXJNXHRCVBYKFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O5S2/c1-3-5-7-14(9,10)13-15(11,12)8-6-4-2/h3-8H2,1-2H3.
What are the key properties of butylsulfonyl butane-1-sulfonate?
butylsulfonyl butane-1-sulfonate has a molecular weight of 258.36 g/mol, XLogP of 1.26, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butylsulfonyl butane-1-sulfonate is sourced from PubChem (CID 13107255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).