C4H5F5N2 — CID 131072941
3,3,4,4,4-pentafluorobutanimidamide (PubChem CID 131072941) has the molecular formula C4H5F5N2 and a molecular weight of 176.09 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluorobutanimidamide.
| Compound Name | 3,3,4,4,4-pentafluorobutanimidamide |
|---|---|
| PubChem CID | 131072941 |
| Molecular Formula | C4H5F5N2 |
| Molecular Weight | 176.09 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 3,3,4,4,4-pentafluorobutanimidamide |
| SMILES | [H]/N=C(\N)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H5F5N2/c5-3(6,1-2(10)11)4(7,8)9/h1H2,(H3,10,11) |
| InChIKey | SZPKIXMPRYOQEQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.09 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|