About 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide
2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide (PubChem CID 13107838) has the molecular formula C9H8BrNO2S
and a molecular weight of 274.14 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide.
Molecular Properties
| Compound Name | 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide |
| PubChem CID | 13107838 |
| Molecular Formula | C9H8BrNO2S |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 272.95 |
| IUPAC Name | 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide |
| SMILES | O=C(O)C[n+]1csc2ccccc21.[Br-] |
| InChI | InChI=1S/C9H7NO2S.BrH/c11-9(12)5-10-6-13-8-4-2-1-3-7(8)10;/h1-4,6H,5H2;1H |
| InChIKey | UEINBJHBQWSAHA-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide?
The IUPAC name of 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide (CID 13107838) is 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide.
What is the SMILES notation for 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide?
The canonical SMILES for 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide is O=C(O)C[n+]1csc2ccccc21.[Br-].
What is the InChIKey of 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide?
The InChIKey is UEINBJHBQWSAHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2S.BrH/c11-9(12)5-10-6-13-8-4-2-1-3-7(8)10;/h1-4,6H,5H2;1H.
What are the key properties of 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide?
2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide has a molecular weight of 274.14 g/mol, XLogP of -1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzothiazol-3-ium-3-yl)acetic acid bromide is sourced from PubChem (CID 13107838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).