C11H15BrN2S — CID 131081685
2-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-bromo-1,3-thiazole (PubChem CID 131081685) has the molecular formula C11H15BrN2S and a molecular weight of 287.23 g/mol. Its IUPAC name is 2-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-bromo-1,3-thiazole.
| Compound Name | 2-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-bromo-1,3-thiazole |
|---|---|
| PubChem CID | 131081685 |
| Molecular Formula | C11H15BrN2S |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-4-bromo-1,3-thiazole |
| SMILES | Brc1csc(N2C[C@H]3CCCC[C@H]3C2)n1 |
| InChI | InChI=1S/C11H15BrN2S/c12-10-7-15-11(13-10)14-5-8-3-1-2-4-9(8)6-14/h7-9H,1-6H2/t8-,9+ |
| InChIKey | MCNKGKXIVSHLQV-DTORHVGOSA-N |
| XLogP | 3.53 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |