C8H10N4S — CID 131082483
5-(4,5-dimethylthiophen-3-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 131082483) has the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. Its IUPAC name is 5-(4,5-dimethylthiophen-3-yl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(4,5-dimethylthiophen-3-yl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 131082483 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 5-(4,5-dimethylthiophen-3-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | Cc1scc(-c2nc(N)n[nH]2)c1C |
| InChI | InChI=1S/C8H10N4S/c1-4-5(2)13-3-6(4)7-10-8(9)12-11-7/h3H,1-2H3,(H3,9,10,11,12) |
| InChIKey | RRLZUHGBBRPKCN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |