About 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid
2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid (PubChem CID 131083966) has the molecular formula C6H7NO3S
and a molecular weight of 173.19 g/mol. Its IUPAC name is 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid.
Molecular Properties
| Compound Name | 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid |
| PubChem CID | 131083966 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid |
| SMILES | Cc1cc(C(O)C(=O)O)sn1 |
| InChI | InChI=1S/C6H7NO3S/c1-3-2-4(11-7-3)5(8)6(9)10/h2,5,8H,1H3,(H,9,10) |
| InChIKey | OEUVMQLFQNRZTP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid?
The IUPAC name of 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid (CID 131083966) is 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid.
What is the SMILES notation for 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid?
The canonical SMILES for 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid is Cc1cc(C(O)C(=O)O)sn1.
What is the InChIKey of 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid?
The InChIKey is OEUVMQLFQNRZTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3S/c1-3-2-4(11-7-3)5(8)6(9)10/h2,5,8H,1H3,(H,9,10).
What are the key properties of 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid?
2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid has a molecular weight of 173.19 g/mol, XLogP of 0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(3-methyl-1,2-thiazol-5-yl)acetic acid is sourced from PubChem (CID 131083966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).