C8H11NO2S — CID 131083972
4-(1,2-thiazol-3-yl)oxan-4-ol (PubChem CID 131083972) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 4-(1,2-thiazol-3-yl)oxan-4-ol.
| Compound Name | 4-(1,2-thiazol-3-yl)oxan-4-ol |
|---|---|
| PubChem CID | 131083972 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 4-(1,2-thiazol-3-yl)oxan-4-ol |
| SMILES | OC1(c2ccsn2)CCOCC1 |
| InChI | InChI=1S/C8H11NO2S/c10-8(2-4-11-5-3-8)7-1-6-12-9-7/h1,6,10H,2-5H2 |
| InChIKey | NJISFQDKEFTGRK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |