About 5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one
5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one (PubChem CID 131084435) has the molecular formula C6H7ClN2O2S
and a molecular weight of 206.65 g/mol. Its IUPAC name is 5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one.
Molecular Properties
| Compound Name | 5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one |
| PubChem CID | 131084435 |
| Molecular Formula | C6H7ClN2O2S |
| Molecular Weight | 206.65 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one |
| SMILES | CCC(=O)Cn1nc(Cl)sc1=O |
| InChI | InChI=1S/C6H7ClN2O2S/c1-2-4(10)3-9-6(11)12-5(7)8-9/h2-3H2,1H3 |
| InChIKey | GPMOXMLTRBTRRW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.65 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one?
The IUPAC name of 5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one (CID 131084435) is 5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one.
What is the SMILES notation for 5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one?
The canonical SMILES for 5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one is CCC(=O)Cn1nc(Cl)sc1=O.
What is the InChIKey of 5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one?
The InChIKey is GPMOXMLTRBTRRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O2S/c1-2-4(10)3-9-6(11)12-5(7)8-9/h2-3H2,1H3.
What are the key properties of 5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one?
5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one has a molecular weight of 206.65 g/mol, XLogP of 0.94, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(2-oxobutyl)-1,3,4-thiadiazol-2-one is sourced from PubChem (CID 131084435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).