About N-ethyl-N,2,4-trimethylfuran-3-carboxamide
N-ethyl-N,2,4-trimethylfuran-3-carboxamide (PubChem CID 131084548) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is N-ethyl-N,2,4-trimethylfuran-3-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-N,2,4-trimethylfuran-3-carboxamide |
| PubChem CID | 131084548 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-ethyl-N,2,4-trimethylfuran-3-carboxamide |
| SMILES | CCN(C)C(=O)c1c(C)coc1C |
| InChI | InChI=1S/C10H15NO2/c1-5-11(4)10(12)9-7(2)6-13-8(9)3/h6H,5H2,1-4H3 |
| InChIKey | HHKWXSCVSKZOPN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-N,2,4-trimethylfuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N,2,4-trimethylfuran-3-carboxamide?
The IUPAC name of N-ethyl-N,2,4-trimethylfuran-3-carboxamide (CID 131084548) is N-ethyl-N,2,4-trimethylfuran-3-carboxamide.
What is the SMILES notation for N-ethyl-N,2,4-trimethylfuran-3-carboxamide?
The canonical SMILES for N-ethyl-N,2,4-trimethylfuran-3-carboxamide is CCN(C)C(=O)c1c(C)coc1C.
What is the InChIKey of N-ethyl-N,2,4-trimethylfuran-3-carboxamide?
The InChIKey is HHKWXSCVSKZOPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-5-11(4)10(12)9-7(2)6-13-8(9)3/h6H,5H2,1-4H3.
What are the key properties of N-ethyl-N,2,4-trimethylfuran-3-carboxamide?
N-ethyl-N,2,4-trimethylfuran-3-carboxamide has a molecular weight of 181.23 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N,2,4-trimethylfuran-3-carboxamide is sourced from PubChem (CID 131084548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).