About 4-(2-fluorobutyl)-3,5-dimethylthiomorpholine
4-(2-fluorobutyl)-3,5-dimethylthiomorpholine (PubChem CID 131085925) has the molecular formula C10H20FNS
and a molecular weight of 205.34 g/mol. Its IUPAC name is 4-(2-fluorobutyl)-3,5-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 4-(2-fluorobutyl)-3,5-dimethylthiomorpholine |
| PubChem CID | 131085925 |
| Molecular Formula | C10H20FNS |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 4-(2-fluorobutyl)-3,5-dimethylthiomorpholine |
| SMILES | CCC(F)CN1C(C)CSCC1C |
| InChI | InChI=1S/C10H20FNS/c1-4-10(11)5-12-8(2)6-13-7-9(12)3/h8-10H,4-7H2,1-3H3 |
| InChIKey | BAHSEMRPYFXGAW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-fluorobutyl)-3,5-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluorobutyl)-3,5-dimethylthiomorpholine?
The IUPAC name of 4-(2-fluorobutyl)-3,5-dimethylthiomorpholine (CID 131085925) is 4-(2-fluorobutyl)-3,5-dimethylthiomorpholine.
What is the SMILES notation for 4-(2-fluorobutyl)-3,5-dimethylthiomorpholine?
The canonical SMILES for 4-(2-fluorobutyl)-3,5-dimethylthiomorpholine is CCC(F)CN1C(C)CSCC1C.
What is the InChIKey of 4-(2-fluorobutyl)-3,5-dimethylthiomorpholine?
The InChIKey is BAHSEMRPYFXGAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20FNS/c1-4-10(11)5-12-8(2)6-13-7-9(12)3/h8-10H,4-7H2,1-3H3.
What are the key properties of 4-(2-fluorobutyl)-3,5-dimethylthiomorpholine?
4-(2-fluorobutyl)-3,5-dimethylthiomorpholine has a molecular weight of 205.34 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluorobutyl)-3,5-dimethylthiomorpholine is sourced from PubChem (CID 131085925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).