About 2-methoxy-N'-pyrazin-2-ylacetohydrazide
2-methoxy-N'-pyrazin-2-ylacetohydrazide (PubChem CID 131086355) has the molecular formula C7H10N4O2
and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-methoxy-N'-pyrazin-2-ylacetohydrazide.
Molecular Properties
| Compound Name | 2-methoxy-N'-pyrazin-2-ylacetohydrazide |
| PubChem CID | 131086355 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 2-methoxy-N'-pyrazin-2-ylacetohydrazide |
| SMILES | COCC(=O)NNc1cnccn1 |
| InChI | InChI=1S/C7H10N4O2/c1-13-5-7(12)11-10-6-4-8-2-3-9-6/h2-4H,5H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | DWEIIIVWLPNRPK-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N'-pyrazin-2-ylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N'-pyrazin-2-ylacetohydrazide?
The IUPAC name of 2-methoxy-N'-pyrazin-2-ylacetohydrazide (CID 131086355) is 2-methoxy-N'-pyrazin-2-ylacetohydrazide.
What is the SMILES notation for 2-methoxy-N'-pyrazin-2-ylacetohydrazide?
The canonical SMILES for 2-methoxy-N'-pyrazin-2-ylacetohydrazide is COCC(=O)NNc1cnccn1.
What is the InChIKey of 2-methoxy-N'-pyrazin-2-ylacetohydrazide?
The InChIKey is DWEIIIVWLPNRPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2/c1-13-5-7(12)11-10-6-4-8-2-3-9-6/h2-4H,5H2,1H3,(H,9,10)(H,11,12).
What are the key properties of 2-methoxy-N'-pyrazin-2-ylacetohydrazide?
2-methoxy-N'-pyrazin-2-ylacetohydrazide has a molecular weight of 182.18 g/mol, XLogP of -0.43, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N'-pyrazin-2-ylacetohydrazide is sourced from PubChem (CID 131086355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).