C7H11N3OS — CID 131086579
5-(oxolan-3-ylmethyl)-1,2,4-thiadiazol-3-amine (PubChem CID 131086579) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 5-(oxolan-3-ylmethyl)-1,2,4-thiadiazol-3-amine.
| Compound Name | 5-(oxolan-3-ylmethyl)-1,2,4-thiadiazol-3-amine |
|---|---|
| PubChem CID | 131086579 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 5-(oxolan-3-ylmethyl)-1,2,4-thiadiazol-3-amine |
| SMILES | Nc1nsc(CC2CCOC2)n1 |
| InChI | InChI=1S/C7H11N3OS/c8-7-9-6(12-10-7)3-5-1-2-11-4-5/h5H,1-4H2,(H2,8,10) |
| InChIKey | QNIDONRQHPGKMH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |