About 1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile
1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile (PubChem CID 131089128) has the molecular formula C10H15FN2
and a molecular weight of 182.24 g/mol. Its IUPAC name is 1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile |
| PubChem CID | 131089128 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile |
| SMILES | CC(F)CCN1CC=C(C#N)CC1 |
| InChI | InChI=1S/C10H15FN2/c1-9(11)2-5-13-6-3-10(8-12)4-7-13/h3,9H,2,4-7H2,1H3 |
| InChIKey | NEGRJZWTOZZQLU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile?
The IUPAC name of 1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile (CID 131089128) is 1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile.
What is the SMILES notation for 1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile?
The canonical SMILES for 1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile is CC(F)CCN1CC=C(C#N)CC1.
What is the InChIKey of 1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile?
The InChIKey is NEGRJZWTOZZQLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2/c1-9(11)2-5-13-6-3-10(8-12)4-7-13/h3,9H,2,4-7H2,1H3.
What are the key properties of 1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile?
1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile has a molecular weight of 182.24 g/mol, XLogP of 1.89, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluorobutyl)-3,6-dihydro-2H-pyridine-4-carbonitrile is sourced from PubChem (CID 131089128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).