About 3-fluoro-N,3-dimethylazetidine-1-carboxamide
3-fluoro-N,3-dimethylazetidine-1-carboxamide (PubChem CID 131089872) has the molecular formula C6H11FN2O
and a molecular weight of 146.16 g/mol. Its IUPAC name is 3-fluoro-N,3-dimethylazetidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-fluoro-N,3-dimethylazetidine-1-carboxamide |
| PubChem CID | 131089872 |
| Molecular Formula | C6H11FN2O |
| Molecular Weight | 146.16 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 3-fluoro-N,3-dimethylazetidine-1-carboxamide |
| SMILES | CNC(=O)N1CC(C)(F)C1 |
| InChI | InChI=1S/C6H11FN2O/c1-6(7)3-9(4-6)5(10)8-2/h3-4H2,1-2H3,(H,8,10) |
| InChIKey | PPUIEKVRHTUJAO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.16 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-N,3-dimethylazetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N,3-dimethylazetidine-1-carboxamide?
The IUPAC name of 3-fluoro-N,3-dimethylazetidine-1-carboxamide (CID 131089872) is 3-fluoro-N,3-dimethylazetidine-1-carboxamide.
What is the SMILES notation for 3-fluoro-N,3-dimethylazetidine-1-carboxamide?
The canonical SMILES for 3-fluoro-N,3-dimethylazetidine-1-carboxamide is CNC(=O)N1CC(C)(F)C1.
What is the InChIKey of 3-fluoro-N,3-dimethylazetidine-1-carboxamide?
The InChIKey is PPUIEKVRHTUJAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FN2O/c1-6(7)3-9(4-6)5(10)8-2/h3-4H2,1-2H3,(H,8,10).
What are the key properties of 3-fluoro-N,3-dimethylazetidine-1-carboxamide?
3-fluoro-N,3-dimethylazetidine-1-carboxamide has a molecular weight of 146.16 g/mol, XLogP of 0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N,3-dimethylazetidine-1-carboxamide is sourced from PubChem (CID 131089872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).