About 2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine
2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine (PubChem CID 131091784) has the molecular formula C8H11ClN4
and a molecular weight of 198.66 g/mol. Its IUPAC name is 2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine.
Molecular Properties
| Compound Name | 2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine |
| PubChem CID | 131091784 |
| Molecular Formula | C8H11ClN4 |
| Molecular Weight | 198.66 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine |
| SMILES | C=CCN(C)c1nc(Cl)ncc1N |
| InChI | InChI=1S/C8H11ClN4/c1-3-4-13(2)7-6(10)5-11-8(9)12-7/h3,5H,1,4,10H2,2H3 |
| InChIKey | QYLSNPKGUKLHGZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.66 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine?
The IUPAC name of 2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine (CID 131091784) is 2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine.
What is the SMILES notation for 2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine?
The canonical SMILES for 2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine is C=CCN(C)c1nc(Cl)ncc1N.
What is the InChIKey of 2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine?
The InChIKey is QYLSNPKGUKLHGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN4/c1-3-4-13(2)7-6(10)5-11-8(9)12-7/h3,5H,1,4,10H2,2H3.
What are the key properties of 2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine?
2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine has a molecular weight of 198.66 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-N-methyl-4-N-prop-2-enylpyrimidine-4,5-diamine is sourced from PubChem (CID 131091784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).