C10H22N2O — CID 131091885
1-(3-aminobutan-2-yl)-4,4-dimethylpyrrolidin-3-ol (PubChem CID 131091885) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-(3-aminobutan-2-yl)-4,4-dimethylpyrrolidin-3-ol.
| Compound Name | 1-(3-aminobutan-2-yl)-4,4-dimethylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 131091885 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 1-(3-aminobutan-2-yl)-4,4-dimethylpyrrolidin-3-ol |
| SMILES | CC(N)C(C)N1CC(O)C(C)(C)C1 |
| InChI | InChI=1S/C10H22N2O/c1-7(11)8(2)12-5-9(13)10(3,4)6-12/h7-9,13H,5-6,11H2,1-4H3 |
| InChIKey | XRCBZJCYSLMTEJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |