C9H15N3O — CID 131091893
5-[(cyclobutylamino)methyl]-2-methyl-1H-pyrazol-3-one (PubChem CID 131091893) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-[(cyclobutylamino)methyl]-2-methyl-1H-pyrazol-3-one.
| Compound Name | 5-[(cyclobutylamino)methyl]-2-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 131091893 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 5-[(cyclobutylamino)methyl]-2-methyl-1H-pyrazol-3-one |
| SMILES | Cn1[nH]c(CNC2CCC2)cc1=O |
| InChI | InChI=1S/C9H15N3O/c1-12-9(13)5-8(11-12)6-10-7-3-2-4-7/h5,7,10-11H,2-4,6H2,1H3 |
| InChIKey | OZHROJDAAISHFJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |