C8H14N2O2 — CID 131091998
2-amino-5-butyl-5-methyl-1,3-oxazol-4-one (PubChem CID 131091998) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-amino-5-butyl-5-methyl-1,3-oxazol-4-one.
| Compound Name | 2-amino-5-butyl-5-methyl-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 131091998 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-amino-5-butyl-5-methyl-1,3-oxazol-4-one |
| SMILES | CCCCC1(C)OC(N)=NC1=O |
| InChI | InChI=1S/C8H14N2O2/c1-3-4-5-8(2)6(11)10-7(9)12-8/h3-5H2,1-2H3,(H2,9,10,11) |
| InChIKey | KCJSQUFLVIFORA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |