C7H3BrIN3S — CID 131092059
3-(3-bromo-4-pyridinyl)-5-iodo-1,2,4-thiadiazole (PubChem CID 131092059) has the molecular formula C7H3BrIN3S and a molecular weight of 368.00 g/mol. Its IUPAC name is 3-(3-bromo-4-pyridinyl)-5-iodo-1,2,4-thiadiazole.
| Compound Name | 3-(3-bromo-4-pyridinyl)-5-iodo-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 131092059 |
| Molecular Formula | C7H3BrIN3S |
| Molecular Weight | 368.00 g/mol |
| Exact Mass | 366.83 |
| IUPAC Name | 3-(3-bromo-4-pyridinyl)-5-iodo-1,2,4-thiadiazole |
| SMILES | Brc1cnccc1-c1nsc(I)n1 |
| InChI | InChI=1S/C7H3BrIN3S/c8-5-3-10-2-1-4(5)6-11-7(9)13-12-6/h1-3H |
| InChIKey | GHHPBYKLKMLEAM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.00 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|