About [oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine
[oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine (PubChem CID 131092070) has the molecular formula C8H13N3OS
and a molecular weight of 199.28 g/mol. Its IUPAC name is [oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine.
Molecular Properties
| Compound Name | [oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine |
| PubChem CID | 131092070 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | [oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine |
| SMILES | NNC(c1ccsn1)C1CCCO1 |
| InChI | InChI=1S/C8H13N3OS/c9-10-8(6-3-5-13-11-6)7-2-1-4-12-7/h3,5,7-8,10H,1-2,4,9H2 |
| InChIKey | BVGSOSKXGHXBBA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine?
The IUPAC name of [oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine (CID 131092070) is [oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine.
What is the SMILES notation for [oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine?
The canonical SMILES for [oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine is NNC(c1ccsn1)C1CCCO1.
What is the InChIKey of [oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine?
The InChIKey is BVGSOSKXGHXBBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS/c9-10-8(6-3-5-13-11-6)7-2-1-4-12-7/h3,5,7-8,10H,1-2,4,9H2.
What are the key properties of [oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine?
[oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine has a molecular weight of 199.28 g/mol, XLogP of 0.83, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [oxolan-2-yl(1,2-thiazol-3-yl)methyl]hydrazine is sourced from PubChem (CID 131092070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).