About 2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol
2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol (PubChem CID 131093371) has the molecular formula C6H7F2NO2S
and a molecular weight of 195.19 g/mol. Its IUPAC name is 2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol |
| PubChem CID | 131093371 |
| Molecular Formula | C6H7F2NO2S |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol |
| SMILES | COc1cc(C(O)C(F)F)sn1 |
| InChI | InChI=1S/C6H7F2NO2S/c1-11-4-2-3(12-9-4)5(10)6(7)8/h2,5-6,10H,1H3 |
| InChIKey | YIQJAJKHKJWVAL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol?
The IUPAC name of 2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol (CID 131093371) is 2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol.
What is the SMILES notation for 2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol?
The canonical SMILES for 2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol is COc1cc(C(O)C(F)F)sn1.
What is the InChIKey of 2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol?
The InChIKey is YIQJAJKHKJWVAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F2NO2S/c1-11-4-2-3(12-9-4)5(10)6(7)8/h2,5-6,10H,1H3.
What are the key properties of 2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol?
2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol has a molecular weight of 195.19 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-1-(3-methoxy-1,2-thiazol-5-yl)ethanol is sourced from PubChem (CID 131093371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).