About 5-methyl-2-(1,2-thiazol-3-yl)aniline
5-methyl-2-(1,2-thiazol-3-yl)aniline (PubChem CID 131093612) has the molecular formula C10H10N2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 5-methyl-2-(1,2-thiazol-3-yl)aniline.
Molecular Properties
| Compound Name | 5-methyl-2-(1,2-thiazol-3-yl)aniline |
| PubChem CID | 131093612 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 5-methyl-2-(1,2-thiazol-3-yl)aniline |
| SMILES | Cc1ccc(-c2ccsn2)c(N)c1 |
| InChI | InChI=1S/C10H10N2S/c1-7-2-3-8(9(11)6-7)10-4-5-13-12-10/h2-6H,11H2,1H3 |
| InChIKey | NABWPZDHIZJQNE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-(1,2-thiazol-3-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(1,2-thiazol-3-yl)aniline?
The IUPAC name of 5-methyl-2-(1,2-thiazol-3-yl)aniline (CID 131093612) is 5-methyl-2-(1,2-thiazol-3-yl)aniline.
What is the SMILES notation for 5-methyl-2-(1,2-thiazol-3-yl)aniline?
The canonical SMILES for 5-methyl-2-(1,2-thiazol-3-yl)aniline is Cc1ccc(-c2ccsn2)c(N)c1.
What is the InChIKey of 5-methyl-2-(1,2-thiazol-3-yl)aniline?
The InChIKey is NABWPZDHIZJQNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S/c1-7-2-3-8(9(11)6-7)10-4-5-13-12-10/h2-6H,11H2,1H3.
What are the key properties of 5-methyl-2-(1,2-thiazol-3-yl)aniline?
5-methyl-2-(1,2-thiazol-3-yl)aniline has a molecular weight of 190.27 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(1,2-thiazol-3-yl)aniline is sourced from PubChem (CID 131093612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).