About 4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one
4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one (PubChem CID 131097833) has the molecular formula C8H10ClN3OS
and a molecular weight of 231.71 g/mol. Its IUPAC name is 4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one |
| PubChem CID | 131097833 |
| Molecular Formula | C8H10ClN3OS |
| Molecular Weight | 231.71 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one |
| SMILES | O=C1CC(CNc2nc(Cl)cs2)CN1 |
| InChI | InChI=1S/C8H10ClN3OS/c9-6-4-14-8(12-6)11-3-5-1-7(13)10-2-5/h4-5H,1-3H2,(H,10,13)(H,11,12) |
| InChIKey | FTSGHEIVOYTKEH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.71 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one?
The IUPAC name of 4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one (CID 131097833) is 4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one.
What is the SMILES notation for 4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one?
The canonical SMILES for 4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one is O=C1CC(CNc2nc(Cl)cs2)CN1.
What is the InChIKey of 4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one?
The InChIKey is FTSGHEIVOYTKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN3OS/c9-6-4-14-8(12-6)11-3-5-1-7(13)10-2-5/h4-5H,1-3H2,(H,10,13)(H,11,12).
What are the key properties of 4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one?
4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one has a molecular weight of 231.71 g/mol, XLogP of 1.34, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]pyrrolidin-2-one is sourced from PubChem (CID 131097833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).