C8H4F2OS — CID 131098282
2,5-difluoro-1-benzothiophen-4-ol (PubChem CID 131098282) has the molecular formula C8H4F2OS and a molecular weight of 186.18 g/mol. Its IUPAC name is 2,5-difluoro-1-benzothiophen-4-ol.
| Compound Name | 2,5-difluoro-1-benzothiophen-4-ol |
|---|---|
| PubChem CID | 131098282 |
| Molecular Formula | C8H4F2OS |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | 2,5-difluoro-1-benzothiophen-4-ol |
| SMILES | Oc1c(F)ccc2sc(F)cc12 |
| InChI | InChI=1S/C8H4F2OS/c9-5-1-2-6-4(8(5)11)3-7(10)12-6/h1-3,11H |
| InChIKey | MOPCINJDFWFYOJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |