C8H14O3 — CID 131098872
2-(5,5-dimethyloxolan-3-yl)acetic acid (PubChem CID 131098872) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-(5,5-dimethyloxolan-3-yl)acetic acid.
| Compound Name | 2-(5,5-dimethyloxolan-3-yl)acetic acid |
|---|---|
| PubChem CID | 131098872 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2-(5,5-dimethyloxolan-3-yl)acetic acid |
| SMILES | CC1(C)CC(CC(=O)O)CO1 |
| InChI | InChI=1S/C8H14O3/c1-8(2)4-6(5-11-8)3-7(9)10/h6H,3-5H2,1-2H3,(H,9,10) |
| InChIKey | NVIHNQJHHGYJQU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |