About N,N-diethylpropanimidamide
N,N-diethylpropanimidamide (PubChem CID 13109962) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is N,N-diethylpropanimidamide.
Molecular Properties
| Compound Name | N,N-diethylpropanimidamide |
| PubChem CID | 13109962 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | N,N-diethylpropanimidamide |
| SMILES | [H]/N=C(\CC)N(CC)CC |
| InChI | InChI=1S/C7H16N2/c1-4-7(8)9(5-2)6-3/h8H,4-6H2,1-3H3/b8-7+ |
| InChIKey | KCIXJSPXBFPFGZ-BQYQJAHWSA-N |
| XLogP | 1.72 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylpropanimidamide?
The IUPAC name of N,N-diethylpropanimidamide (CID 13109962) is N,N-diethylpropanimidamide.
What is the SMILES notation for N,N-diethylpropanimidamide?
The canonical SMILES for N,N-diethylpropanimidamide is [H]/N=C(\CC)N(CC)CC.
What is the InChIKey of N,N-diethylpropanimidamide?
The InChIKey is KCIXJSPXBFPFGZ-BQYQJAHWSA-N. The full InChI is InChI=1S/C7H16N2/c1-4-7(8)9(5-2)6-3/h8H,4-6H2,1-3H3/b8-7+.
What are the key properties of N,N-diethylpropanimidamide?
N,N-diethylpropanimidamide has a molecular weight of 128.22 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylpropanimidamide is sourced from PubChem (CID 13109962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).