About thieno[2,3-c]pyridine-4-sulfonyl chloride
thieno[2,3-c]pyridine-4-sulfonyl chloride (PubChem CID 131100587) has the molecular formula C7H4ClNO2S2
and a molecular weight of 233.70 g/mol. Its IUPAC name is thieno[2,3-c]pyridine-4-sulfonyl chloride.
Molecular Properties
| Compound Name | thieno[2,3-c]pyridine-4-sulfonyl chloride |
| PubChem CID | 131100587 |
| Molecular Formula | C7H4ClNO2S2 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 232.94 |
| IUPAC Name | thieno[2,3-c]pyridine-4-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cncc2sccc12 |
| InChI | InChI=1S/C7H4ClNO2S2/c8-13(10,11)7-4-9-3-6-5(7)1-2-12-6/h1-4H |
| InChIKey | MFDSPXIKGVGKAW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thieno[2,3-c]pyridine-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-c]pyridine-4-sulfonyl chloride?
The IUPAC name of thieno[2,3-c]pyridine-4-sulfonyl chloride (CID 131100587) is thieno[2,3-c]pyridine-4-sulfonyl chloride.
What is the SMILES notation for thieno[2,3-c]pyridine-4-sulfonyl chloride?
The canonical SMILES for thieno[2,3-c]pyridine-4-sulfonyl chloride is O=S(=O)(Cl)c1cncc2sccc12.
What is the InChIKey of thieno[2,3-c]pyridine-4-sulfonyl chloride?
The InChIKey is MFDSPXIKGVGKAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClNO2S2/c8-13(10,11)7-4-9-3-6-5(7)1-2-12-6/h1-4H.
What are the key properties of thieno[2,3-c]pyridine-4-sulfonyl chloride?
thieno[2,3-c]pyridine-4-sulfonyl chloride has a molecular weight of 233.70 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-c]pyridine-4-sulfonyl chloride is sourced from PubChem (CID 131100587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).