C9H18O2S — CID 131102374
(1S)-1-[(2S,6S)-4,4,6-trimethyl-1,3-oxathian-2-yl]ethanol (PubChem CID 131102374) has the molecular formula C9H18O2S and a molecular weight of 190.31 g/mol. Its IUPAC name is (1S)-1-[(2S,6S)-4,4,6-trimethyl-1,3-oxathian-2-yl]ethanol.
| Compound Name | (1S)-1-[(2S,6S)-4,4,6-trimethyl-1,3-oxathian-2-yl]ethanol |
|---|---|
| PubChem CID | 131102374 |
| Molecular Formula | C9H18O2S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (1S)-1-[(2S,6S)-4,4,6-trimethyl-1,3-oxathian-2-yl]ethanol |
| SMILES | C[C@H](O)[C@H]1O[C@@H](C)CC(C)(C)S1 |
| InChI | InChI=1S/C9H18O2S/c1-6-5-9(3,4)12-8(11-6)7(2)10/h6-8,10H,5H2,1-4H3/t6-,7-,8-/m0/s1 |
| InChIKey | IHAOEFOTLZASSP-FXQIFTODSA-N |
| XLogP | 2.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |