About 4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol
4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol (PubChem CID 131104221) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol.
Molecular Properties
| Compound Name | 4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol |
| PubChem CID | 131104221 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol |
| SMILES | Cc1ncc(CO)c([C@H](N)CN)c1O |
| InChI | InChI=1S/C9H15N3O2/c1-5-9(14)8(7(11)2-10)6(4-13)3-12-5/h3,7,13-14H,2,4,10-11H2,1H3/t7-/m1/s1 |
| InChIKey | UIOOGDLNZWYSBI-SSDOTTSWSA-N |
| XLogP | -0.45 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol?
The IUPAC name of 4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol (CID 131104221) is 4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol.
What is the SMILES notation for 4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol?
The canonical SMILES for 4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol is Cc1ncc(CO)c([C@H](N)CN)c1O.
What is the InChIKey of 4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol?
The InChIKey is UIOOGDLNZWYSBI-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-5-9(14)8(7(11)2-10)6(4-13)3-12-5/h3,7,13-14H,2,4,10-11H2,1H3/t7-/m1/s1.
What are the key properties of 4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol?
4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol has a molecular weight of 197.24 g/mol, XLogP of -0.45, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S)-1,2-diaminoethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol is sourced from PubChem (CID 131104221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).