About N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine
N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine (PubChem CID 13110582) has the molecular formula C10H20Cl2NO2P
and a molecular weight of 288.16 g/mol. Its IUPAC name is N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine.
Molecular Properties
| Compound Name | N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine |
| PubChem CID | 13110582 |
| Molecular Formula | C10H20Cl2NO2P |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine |
| SMILES | CCCOP(OC(C)=C(Cl)Cl)N(CC)CC |
| InChI | InChI=1S/C10H20Cl2NO2P/c1-5-8-14-16(13(6-2)7-3)15-9(4)10(11)12/h5-8H2,1-4H3 |
| InChIKey | ZKGZWQAHTABBDX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine?
The IUPAC name of N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine (CID 13110582) is N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine.
What is the SMILES notation for N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine?
The canonical SMILES for N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine is CCCOP(OC(C)=C(Cl)Cl)N(CC)CC.
What is the InChIKey of N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine?
The InChIKey is ZKGZWQAHTABBDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20Cl2NO2P/c1-5-8-14-16(13(6-2)7-3)15-9(4)10(11)12/h5-8H2,1-4H3.
What are the key properties of N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine?
N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine has a molecular weight of 288.16 g/mol, XLogP of 4.66, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1,1-dichloroprop-1-en-2-yloxy(propoxy)phosphanyl]-N-ethylethanamine is sourced from PubChem (CID 13110582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).