C10H12IN — CID 131106139
(3S)-6-iodo-3-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 131106139) has the molecular formula C10H12IN and a molecular weight of 273.12 g/mol. Its IUPAC name is (3S)-6-iodo-3-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (3S)-6-iodo-3-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 131106139 |
| Molecular Formula | C10H12IN |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (3S)-6-iodo-3-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | C[C@H]1Cc2cc(I)ccc2CN1 |
| InChI | InChI=1S/C10H12IN/c1-7-4-9-5-10(11)3-2-8(9)6-12-7/h2-3,5,7,12H,4,6H2,1H3/t7-/m0/s1 |
| InChIKey | QWRZONKYFUZKAH-ZETCQYMHSA-N |
| XLogP | 2.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|