C11H20O — CID 131107477
cis-(2S,5S)-5-ethyl-2,4,4-trimethylcyclohexan-1-one (PubChem CID 131107477) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is cis-(2S,5S)-5-ethyl-2,4,4-trimethylcyclohexan-1-one.
| Compound Name | cis-(2S,5S)-5-ethyl-2,4,4-trimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 131107477 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | cis-(2S,5S)-5-ethyl-2,4,4-trimethylcyclohexan-1-one |
| SMILES | CC[C@H]1CC(=O)[C@@H](C)CC1(C)C |
| InChI | InChI=1S/C11H20O/c1-5-9-6-10(12)8(2)7-11(9,3)4/h8-9H,5-7H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | LJCJKUVIDKWUPR-IUCAKERBSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |