C7H7FN6 — CID 131107522
5-fluoro-N-(2H-triazol-4-ylmethyl)pyrimidin-2-amine (PubChem CID 131107522) has the molecular formula C7H7FN6 and a molecular weight of 194.17 g/mol. Its IUPAC name is 5-fluoro-N-(2H-triazol-4-ylmethyl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-(2H-triazol-4-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 131107522 |
| Molecular Formula | C7H7FN6 |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 5-fluoro-N-(2H-triazol-4-ylmethyl)pyrimidin-2-amine |
| SMILES | Fc1cnc(NCc2cn[nH]n2)nc1 |
| InChI | InChI=1S/C7H7FN6/c8-5-1-9-7(10-2-5)11-3-6-4-12-14-13-6/h1-2,4H,3H2,(H,9,10,11)(H,12,13,14) |
| InChIKey | YZMZXRKHKPXRBK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |