C12H32Si4 — CID 13110831
trimethyl-(1,1,3,3-tetramethyl-4-trimethylsilyl-1,3-disiletan-2-yl)silane (PubChem CID 13110831) has the molecular formula C12H32Si4 and a molecular weight of 288.73 g/mol. Its IUPAC name is trimethyl-(1,1,3,3-tetramethyl-4-trimethylsilyl-1,3-disiletan-2-yl)silane.
| Compound Name | trimethyl-(1,1,3,3-tetramethyl-4-trimethylsilyl-1,3-disiletan-2-yl)silane |
|---|---|
| PubChem CID | 13110831 |
| Molecular Formula | C12H32Si4 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | trimethyl-(1,1,3,3-tetramethyl-4-trimethylsilyl-1,3-disiletan-2-yl)silane |
| SMILES | C[Si](C)(C)C1[Si](C)(C)C([Si](C)(C)C)[Si]1(C)C |
| InChI | InChI=1S/C12H32Si4/c1-13(2,3)11-15(7,8)12(14(4,5)6)16(11,9)10/h11-12H,1-10H3 |
| InChIKey | LKZJOKDQNCPIPA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|