C20H30N2O4 — CID 131108775
tert-butyl (2R)-2-[[ethyl(phenylmethoxycarbonyl)amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 131108775) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[ethyl(phenylmethoxycarbonyl)amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[ethyl(phenylmethoxycarbonyl)amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 131108775 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | tert-butyl (2R)-2-[[ethyl(phenylmethoxycarbonyl)amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CCN(C[C@H]1CCCN1C(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H30N2O4/c1-5-21(18(23)25-15-16-10-7-6-8-11-16)14-17-12-9-13-22(17)19(24)26-20(2,3)4/h6-8,10-11,17H,5,9,12-15H2,1-4H3/t17-/m1/s1 |
| InChIKey | BRINHDUZJQRBPM-QGZVFWFLSA-N |
| XLogP | 4.04 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |