About CID 13110935
CID 13110935 (PubChem CID 13110935) has the molecular formula C9H15O4
and a molecular weight of 187.21 g/mol.
Molecular Properties
| Compound Name | CID 13110935 |
| PubChem CID | 13110935 |
| Molecular Formula | C9H15O4 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C(CC)=C([O])OCC |
| InChI | InChI=1S/C9H15O4/c1-4-7(8(10)12-5-2)9(11)13-6-3/h4-6H2,1-3H3 |
| InChIKey | VVEUUSHUVAGWTL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 13110935 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 13110935?
The IUPAC name of CID 13110935 (CID 13110935) is not available.
What is the SMILES notation for CID 13110935?
The canonical SMILES for CID 13110935 is CCOC(=O)C(CC)=C([O])OCC.
What is the InChIKey of CID 13110935?
The InChIKey is VVEUUSHUVAGWTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15O4/c1-4-7(8(10)12-5-2)9(11)13-6-3/h4-6H2,1-3H3.
What are the key properties of CID 13110935?
CID 13110935 has a molecular weight of 187.21 g/mol, XLogP of 1.64, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 13110935 is sourced from PubChem (CID 13110935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).