About 1,2-dibromocyclododecane
1,2-dibromocyclododecane (PubChem CID 13111000) has the molecular formula C12H22Br2
and a molecular weight of 326.12 g/mol. Its IUPAC name is 1,2-dibromocyclododecane.
Molecular Properties
| Compound Name | 1,2-dibromocyclododecane |
| PubChem CID | 13111000 |
| Molecular Formula | C12H22Br2 |
| Molecular Weight | 326.12 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 1,2-dibromocyclododecane |
| SMILES | BrC1CCCCCCCCCCC1Br |
| InChI | InChI=1S/C12H22Br2/c13-11-9-7-5-3-1-2-4-6-8-10-12(11)14/h11-12H,1-10H2 |
| InChIKey | PZRITHASQSMCIZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.12 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dibromocyclododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibromocyclododecane?
The IUPAC name of 1,2-dibromocyclododecane (CID 13111000) is 1,2-dibromocyclododecane.
What is the SMILES notation for 1,2-dibromocyclododecane?
The canonical SMILES for 1,2-dibromocyclododecane is BrC1CCCCCCCCCCC1Br.
What is the InChIKey of 1,2-dibromocyclododecane?
The InChIKey is PZRITHASQSMCIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22Br2/c13-11-9-7-5-3-1-2-4-6-8-10-12(11)14/h11-12H,1-10H2.
What are the key properties of 1,2-dibromocyclododecane?
1,2-dibromocyclododecane has a molecular weight of 326.12 g/mol, XLogP of 5.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibromocyclododecane is sourced from PubChem (CID 13111000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).