About 2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one
2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one (PubChem CID 13111046) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one |
| PubChem CID | 13111046 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one |
| SMILES | CC/C=C\CC1CC=CC(=O)O1 |
| InChI | InChI=1S/C10H14O2/c1-2-3-4-6-9-7-5-8-10(11)12-9/h3-5,8-9H,2,6-7H2,1H3/b4-3- |
| InChIKey | VYPONAGZHAJHGT-ARJAWSKDSA-N |
| XLogP | 2.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one?
The IUPAC name of 2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one (CID 13111046) is 2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one.
What is the SMILES notation for 2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one?
The canonical SMILES for 2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one is CC/C=C\CC1CC=CC(=O)O1.
What is the InChIKey of 2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one?
The InChIKey is VYPONAGZHAJHGT-ARJAWSKDSA-N. The full InChI is InChI=1S/C10H14O2/c1-2-3-4-6-9-7-5-8-10(11)12-9/h3-5,8-9H,2,6-7H2,1H3/b4-3-.
What are the key properties of 2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one?
2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one has a molecular weight of 166.22 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-pent-2-enyl]-2,3-dihydropyran-6-one is sourced from PubChem (CID 13111046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).