About cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol
cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol (PubChem CID 131110771) has the molecular formula C11H17NOS
and a molecular weight of 211.33 g/mol. Its IUPAC name is cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol |
| PubChem CID | 131110771 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol |
| SMILES | Cc1cc(C(O)C2CCCCC2)sn1 |
| InChI | InChI=1S/C11H17NOS/c1-8-7-10(14-12-8)11(13)9-5-3-2-4-6-9/h7,9,11,13H,2-6H2,1H3 |
| InChIKey | MACLILLUTVHBLB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol?
The IUPAC name of cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol (CID 131110771) is cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol.
What is the SMILES notation for cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol?
The canonical SMILES for cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol is Cc1cc(C(O)C2CCCCC2)sn1.
What is the InChIKey of cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol?
The InChIKey is MACLILLUTVHBLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NOS/c1-8-7-10(14-12-8)11(13)9-5-3-2-4-6-9/h7,9,11,13H,2-6H2,1H3.
What are the key properties of cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol?
cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol has a molecular weight of 211.33 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(3-methyl-1,2-thiazol-5-yl)methanol is sourced from PubChem (CID 131110771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).