About 1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate
1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate (PubChem CID 13111115) has the molecular formula C9H16O5Si
and a molecular weight of 232.31 g/mol. Its IUPAC name is 1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate |
| PubChem CID | 13111115 |
| Molecular Formula | C9H16O5Si |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate |
| SMILES | COC(=O)CC(=O)CC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C9H16O5Si/c1-13-8(11)5-7(10)6-9(12)14-15(2,3)4/h5-6H2,1-4H3 |
| InChIKey | JIFWNRBXVFDXGX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate?
The IUPAC name of 1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate (CID 13111115) is 1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate.
What is the SMILES notation for 1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate?
The canonical SMILES for 1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate is COC(=O)CC(=O)CC(=O)O[Si](C)(C)C.
What is the InChIKey of 1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate?
The InChIKey is JIFWNRBXVFDXGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O5Si/c1-13-8(11)5-7(10)6-9(12)14-15(2,3)4/h5-6H2,1-4H3.
What are the key properties of 1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate?
1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate has a molecular weight of 232.31 g/mol, XLogP of 0.89, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 5-O-trimethylsilyl 3-oxopentanedioate is sourced from PubChem (CID 13111115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).