C9H12N2O — CID 13111241
1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-2-one (PubChem CID 13111241) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-2-one.
| Compound Name | 1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-2-one |
|---|---|
| PubChem CID | 13111241 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-2-one |
| SMILES | O=c1ncc2c([nH]1)CCCCC2 |
| InChI | InChI=1S/C9H12N2O/c12-9-10-6-7-4-2-1-3-5-8(7)11-9/h6H,1-5H2,(H,10,11,12) |
| InChIKey | SWTLYDHVJOFEER-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |