triazolo[1,5-a]pyridine-3-carboxylic acid

C7H5N3O2 — CID 13111409

IUPACtriazolo[1,5-a]pyridine-3-carboxylic acid
SMILESO=C(O)c1nnn2ccccc12
InChIInChI=1S/C7H5N3O2/c11-7(12)6-5-3-1-2-4-10(5)9-8-6/h1-4H,(H,11,12)
InChIKeyBVLJZTXTQSMURL-UHFFFAOYSA-N
MW163.14 g/mol
LogP0.43
Rot. Bonds1

About triazolo[1,5-a]pyridine-3-carboxylic acid

triazolo[1,5-a]pyridine-3-carboxylic acid (PubChem CID 13111409) has the molecular formula C7H5N3O2 and a molecular weight of 163.14 g/mol. Its IUPAC name is triazolo[1,5-a]pyridine-3-carboxylic acid.

Molecular Properties

Compound Nametriazolo[1,5-a]pyridine-3-carboxylic acid
PubChem CID13111409
Molecular FormulaC7H5N3O2
Molecular Weight163.14 g/mol
Exact Mass163.04
IUPAC Nametriazolo[1,5-a]pyridine-3-carboxylic acid
SMILESO=C(O)c1nnn2ccccc12
InChIInChI=1S/C7H5N3O2/c11-7(12)6-5-3-1-2-4-10(5)9-8-6/h1-4H,(H,11,12)
InChIKeyBVLJZTXTQSMURL-UHFFFAOYSA-N
XLogP0.43
TPSA67.49 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.14
LogP ≤ 50.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze triazolo[1,5-a]pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of triazolo[1,5-a]pyridine-3-carboxylic acid?
The IUPAC name of triazolo[1,5-a]pyridine-3-carboxylic acid (CID 13111409) is triazolo[1,5-a]pyridine-3-carboxylic acid.
What is the SMILES notation for triazolo[1,5-a]pyridine-3-carboxylic acid?
The canonical SMILES for triazolo[1,5-a]pyridine-3-carboxylic acid is O=C(O)c1nnn2ccccc12.
What is the InChIKey of triazolo[1,5-a]pyridine-3-carboxylic acid?
The InChIKey is BVLJZTXTQSMURL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2/c11-7(12)6-5-3-1-2-4-10(5)9-8-6/h1-4H,(H,11,12).
What are the key properties of triazolo[1,5-a]pyridine-3-carboxylic acid?
triazolo[1,5-a]pyridine-3-carboxylic acid has a molecular weight of 163.14 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triazolo[1,5-a]pyridine-3-carboxylic acid is sourced from PubChem (CID 13111409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).