C10H21N3O — CID 131114315
(3R,5S)-5-[(piperidin-3-ylamino)methyl]pyrrolidin-3-ol (PubChem CID 131114315) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is (3R,5S)-5-[(piperidin-3-ylamino)methyl]pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-[(piperidin-3-ylamino)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 131114315 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (3R,5S)-5-[(piperidin-3-ylamino)methyl]pyrrolidin-3-ol |
| SMILES | O[C@H]1CN[C@H](CNC2CCCNC2)C1 |
| InChI | InChI=1S/C10H21N3O/c14-10-4-9(13-7-10)6-12-8-2-1-3-11-5-8/h8-14H,1-7H2/t8?,9-,10+/m0/s1 |
| InChIKey | VLIWDVHNPIZOGV-CBMCFHRWSA-N |
| XLogP | -0.95 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |