C10H19N3O — CID 131114361
3,3-dimethyl-N-pyrrolidin-3-ylazetidine-2-carboxamide (PubChem CID 131114361) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 3,3-dimethyl-N-pyrrolidin-3-ylazetidine-2-carboxamide.
| Compound Name | 3,3-dimethyl-N-pyrrolidin-3-ylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 131114361 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 3,3-dimethyl-N-pyrrolidin-3-ylazetidine-2-carboxamide |
| SMILES | CC1(C)CNC1C(=O)NC1CCNC1 |
| InChI | InChI=1S/C10H19N3O/c1-10(2)6-12-8(10)9(14)13-7-3-4-11-5-7/h7-8,11-12H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | YZQRAEYOCCGBSU-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |