C9H15FN4 — CID 131114374
N-(3-fluorobutyl)-5,6-dimethyl-1,2,4-triazin-3-amine (PubChem CID 131114374) has the molecular formula C9H15FN4 and a molecular weight of 198.24 g/mol. Its IUPAC name is N-(3-fluorobutyl)-5,6-dimethyl-1,2,4-triazin-3-amine.
| Compound Name | N-(3-fluorobutyl)-5,6-dimethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 131114374 |
| Molecular Formula | C9H15FN4 |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | N-(3-fluorobutyl)-5,6-dimethyl-1,2,4-triazin-3-amine |
| SMILES | Cc1nnc(NCCC(C)F)nc1C |
| InChI | InChI=1S/C9H15FN4/c1-6(10)4-5-11-9-12-7(2)8(3)13-14-9/h6H,4-5H2,1-3H3,(H,11,12,14) |
| InChIKey | HZYJHAMMNJLAQP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |