About 4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine
4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine (PubChem CID 131115100) has the molecular formula C6H7BrF3N3
and a molecular weight of 258.04 g/mol. Its IUPAC name is 4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine |
| PubChem CID | 131115100 |
| Molecular Formula | C6H7BrF3N3 |
| Molecular Weight | 258.04 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine |
| SMILES | Cc1nn(CC(F)(F)F)c(N)c1Br |
| InChI | InChI=1S/C6H7BrF3N3/c1-3-4(7)5(11)13(12-3)2-6(8,9)10/h2,11H2,1H3 |
| InChIKey | JCGMUADMIOTPCF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.04 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine?
The IUPAC name of 4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine (CID 131115100) is 4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine.
What is the SMILES notation for 4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine?
The canonical SMILES for 4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine is Cc1nn(CC(F)(F)F)c(N)c1Br.
What is the InChIKey of 4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine?
The InChIKey is JCGMUADMIOTPCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrF3N3/c1-3-4(7)5(11)13(12-3)2-6(8,9)10/h2,11H2,1H3.
What are the key properties of 4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine?
4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine has a molecular weight of 258.04 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-methyl-1-(2,2,2-trifluoroethyl)pyrazol-5-amine is sourced from PubChem (CID 131115100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).