C8H13ClO — CID 131115211
(3aS,7aR)-4-chloro-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran (PubChem CID 131115211) has the molecular formula C8H13ClO and a molecular weight of 160.64 g/mol. Its IUPAC name is (3aS,7aR)-4-chloro-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran.
| Compound Name | (3aS,7aR)-4-chloro-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran |
|---|---|
| PubChem CID | 131115211 |
| Molecular Formula | C8H13ClO |
| Molecular Weight | 160.64 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (3aS,7aR)-4-chloro-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran |
| SMILES | ClC1CCC[C@H]2COC[C@@H]12 |
| InChI | InChI=1S/C8H13ClO/c9-8-3-1-2-6-4-10-5-7(6)8/h6-8H,1-5H2/t6-,7+,8?/m0/s1 |
| InChIKey | RRWWOVRTCIKWIJ-KJFJCRTCSA-N |
| XLogP | 2.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.64 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|