About (Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine
(Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine (PubChem CID 13111698) has the molecular formula C12H31NSi3
and a molecular weight of 273.64 g/mol. Its IUPAC name is (Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine |
| PubChem CID | 13111698 |
| Molecular Formula | C12H31NSi3 |
| Molecular Weight | 273.64 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | (Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine |
| SMILES | C[Si](C)(C)/C=C\CN([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H31NSi3/c1-14(2,3)12-10-11-13(15(4,5)6)16(7,8)9/h10,12H,11H2,1-9H3/b12-10- |
| InChIKey | IJDKLRVAUNVIBK-BENRWUELSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine?
The IUPAC name of (Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine (CID 13111698) is (Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine.
What is the SMILES notation for (Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine?
The canonical SMILES for (Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine is C[Si](C)(C)/C=C\CN([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of (Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine?
The InChIKey is IJDKLRVAUNVIBK-BENRWUELSA-N. The full InChI is InChI=1S/C12H31NSi3/c1-14(2,3)12-10-11-13(15(4,5)6)16(7,8)9/h10,12H,11H2,1-9H3/b12-10-.
What are the key properties of (Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine?
(Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine has a molecular weight of 273.64 g/mol, XLogP of 4.39, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N,3-tris(trimethylsilyl)prop-2-en-1-amine is sourced from PubChem (CID 13111698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).