About cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone
cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone (PubChem CID 131119087) has the molecular formula C10H11NOS
and a molecular weight of 193.27 g/mol. Its IUPAC name is cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone.
Molecular Properties
| Compound Name | cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone |
| PubChem CID | 131119087 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone |
| SMILES | Cc1cc(C(=O)C2=CCCC2)sn1 |
| InChI | InChI=1S/C10H11NOS/c1-7-6-9(13-11-7)10(12)8-4-2-3-5-8/h4,6H,2-3,5H2,1H3 |
| InChIKey | UZSBMPITTXCUTG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone?
The IUPAC name of cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone (CID 131119087) is cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone.
What is the SMILES notation for cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone?
The canonical SMILES for cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone is Cc1cc(C(=O)C2=CCCC2)sn1.
What is the InChIKey of cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone?
The InChIKey is UZSBMPITTXCUTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NOS/c1-7-6-9(13-11-7)10(12)8-4-2-3-5-8/h4,6H,2-3,5H2,1H3.
What are the key properties of cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone?
cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone has a molecular weight of 193.27 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl-(3-methyl-1,2-thiazol-5-yl)methanone is sourced from PubChem (CID 131119087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).