C11H15NOS — CID 131119922
N-[2-(thiophen-3-ylmethyl)cyclohexylidene]hydroxylamine (PubChem CID 131119922) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is N-[2-(thiophen-3-ylmethyl)cyclohexylidene]hydroxylamine.
| Compound Name | N-[2-(thiophen-3-ylmethyl)cyclohexylidene]hydroxylamine |
|---|---|
| PubChem CID | 131119922 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | N-[2-(thiophen-3-ylmethyl)cyclohexylidene]hydroxylamine |
| SMILES | ON=C1CCCCC1Cc1ccsc1 |
| InChI | InChI=1S/C11H15NOS/c13-12-11-4-2-1-3-10(11)7-9-5-6-14-8-9/h5-6,8,10,13H,1-4,7H2 |
| InChIKey | IGAALRBLPBALAT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|